Products 20143-46-8
CAS 20143-46-8 is the registry number for 2-(2,6-Dichlorophenoxy)acetyl chloride, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g.
2-(2,6-dichlorophenoxy)acetyl chloride (CAS 20143-46-8) is a chemical compound with the molecular formula C8H5Cl3O2 and a molecular weight of 239.5 g/mol. IUPAC name: 2-(2,6-dichlorophenoxy)acetyl chloride. InChIKey: RPNBBIYJWHBRED-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl3O2 |
|---|---|
| Molecular weight | 239.5 g/mol |
| IUPAC name | 2-(2,6-dichlorophenoxy)acetyl chloride |
| InChIKey | RPNBBIYJWHBRED-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)OCC(=O)Cl)Cl |
Computed by PubChem (NCBI)