cas: 1226776-82-4 — see every product listed under this CAS number, including other names
2-(2,6-Difluoro-4-nitrophenyl)propanoic acid, ≥95%, ≥95% (CAS 1226776-82-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1128LM-250mg |
| cas | 1226776-82-4 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 501.20 Pln | |
| Chemat | 1g | 1163.60 Pln | |
| Chemat | 5g | 2872.40 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
2-(2,6-difluoro-4-nitrophenyl)propanoic acid (CAS 1226776-82-4) is a chemical compound with the molecular formula C9H7F2NO4 and a molecular weight of 231.15 g/mol. IUPAC name: 2-(2,6-difluoro-4-nitrophenyl)propanoic acid. InChIKey: BLZPGURBRHOGGM-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO4 |
|---|---|
| Molecular weight | 231.15 g/mol |
| IUPAC name | 2-(2,6-difluoro-4-nitrophenyl)propanoic acid |
| InChIKey | BLZPGURBRHOGGM-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=C1F)[N+](=O)[O-])F)C(=O)O |
Computed by PubChem (NCBI)