CAS 2451905-67-0 is the registry number for 6-Amino-2,2-difluoro-4-methylbenzo[d][1,3]dioxole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-amino-2,2-difluoro-4-methyl-1,3-benzodioxole-5-carboxylic acid (CAS 2451905-67-0) is a chemical compound with the molecular formula C9H7F2NO4 and a molecular weight of 231.15 g/mol. IUPAC name: 6-amino-2,2-difluoro-4-methyl-1,3-benzodioxole-5-carboxylic acid. InChIKey: QOPFJHQCHMJGNZ-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO4 |
|---|---|
| Molecular weight | 231.15 g/mol |
| IUPAC name | 6-amino-2,2-difluoro-4-methyl-1,3-benzodioxole-5-carboxylic acid |
| InChIKey | QOPFJHQCHMJGNZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC2=C1OC(O2)(F)F)N)C(=O)O |
Computed by PubChem (NCBI)