Products 150368-36-8
CAS 150368-36-8 appears in our catalog under these names: Ethyl 2,6-difluoro-3-nitrobenzoate, 95%, Ethyl 2,6-difluoro-3-nitrobenzoate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g.
Ethyl 2,6-difluoro-3-nitrobenzoate (CAS 150368-36-8) is a chemical compound with the molecular formula C9H7F2NO4 and a molecular weight of 231.15 g/mol. IUPAC name: ethyl 2,6-difluoro-3-nitrobenzoate. InChIKey: NOIKETTVAGMFKJ-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO4 |
|---|---|
| Molecular weight | 231.15 g/mol |
| IUPAC name | ethyl 2,6-difluoro-3-nitrobenzoate |
| InChIKey | NOIKETTVAGMFKJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)