CAS 1806313-89-2 is the registry number for Methyl 2-(4,5-difluoro-2-nitrophenyl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 2-(4,5-difluoro-2-nitrophenyl)acetate (CAS 1806313-89-2) is a chemical compound with the molecular formula C9H7F2NO4 and a molecular weight of 231.15 g/mol. IUPAC name: methyl 2-(4,5-difluoro-2-nitrophenyl)acetate. InChIKey: IHEAFDFRXCJRCU-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO4 |
|---|---|
| Molecular weight | 231.15 g/mol |
| IUPAC name | methyl 2-(4,5-difluoro-2-nitrophenyl)acetate |
| InChIKey | IHEAFDFRXCJRCU-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC(=C(C=C1[N+](=O)[O-])F)F |
Computed by PubChem (NCBI)