Products 1226776-82-4
CAS 1226776-82-4 appears in our catalog under these names: 2-(2,6-Difluoro-4-nitrophenyl)propanoic acid, 2-(2,6-Difluoro-4-nitrophenyl)propanoic acid, 95%, 2-(2,6-Difluoro-4-nitrophenyl)propanoic acid, ≥95%, ≥95%. Offered by: Fluorochem, Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 5g.
2-(2,6-difluoro-4-nitrophenyl)propanoic acid (CAS 1226776-82-4) is a chemical compound with the molecular formula C9H7F2NO4 and a molecular weight of 231.15 g/mol. IUPAC name: 2-(2,6-difluoro-4-nitrophenyl)propanoic acid. InChIKey: BLZPGURBRHOGGM-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO4 |
|---|---|
| Molecular weight | 231.15 g/mol |
| IUPAC name | 2-(2,6-difluoro-4-nitrophenyl)propanoic acid |
| InChIKey | BLZPGURBRHOGGM-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=C1F)[N+](=O)[O-])F)C(=O)O |
Computed by PubChem (NCBI)