cas: 1226776-82-4 — see every product listed under this CAS number, including other names
2-(2,6-Difluoro-4-nitrophenyl)propanoic acid (CAS 1226776-82-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F767450-250MG |
| cas | 1226776-82-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 799.74 Pln | |
| Fluorochem | 1g | 1903.51 Pln | |
| Fluorochem | 5g | 4730.64 Pln |
| delivery time | 3-4 weeks |
|---|
2-(2,6-difluoro-4-nitrophenyl)propanoic acid (CAS 1226776-82-4) is a chemical compound with the molecular formula C9H7F2NO4 and a molecular weight of 231.15 g/mol. IUPAC name: 2-(2,6-difluoro-4-nitrophenyl)propanoic acid. InChIKey: BLZPGURBRHOGGM-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO4 |
|---|---|
| Molecular weight | 231.15 g/mol |
| IUPAC name | 2-(2,6-difluoro-4-nitrophenyl)propanoic acid |
| InChIKey | BLZPGURBRHOGGM-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=C1F)[N+](=O)[O-])F)C(=O)O |
Computed by PubChem (NCBI)