cas: 23353-14-2 — see every product listed under this CAS number, including other names
2-(2-(4-Methoxyphenyl)thiazol-4-yl)acetic acid 95% (CAS 23353-14-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A377000-250mg |
| cas | 23353-14-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 281.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A377000 |
2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid (CAS 23353-14-2) is a chemical compound with the molecular formula C12H11NO3S and a molecular weight of 249.29 g/mol. IUPAC name: 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid. InChIKey: HWRQFRXTBPYUEK-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3S |
|---|---|
| Molecular weight | 249.29 g/mol |
| IUPAC name | 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid |
| InChIKey | HWRQFRXTBPYUEK-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NC(=CS2)CC(=O)O |
Computed by PubChem (NCBI)