2-(2-(sec-Butyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%
cas: 2621936-59-0 — see every product listed under this CAS number, including other names
2-(2-(sec-Butyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95% (CAS 2621936-59-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1503051-100mg |
| cas | 2621936-59-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 375.94 Pln | |
| Ambeed | 250mg | 604.00 Pln | |
| Ambeed | 1g | 1477.31 Pln | |
| Ambeed | 5g | 5037.31 Pln | |
| Chemat | 100mg | 395.60 Pln | |
| Chemat | 1g | 1538.00 Pln | |
| Chemat | 5g | 5219.60 Pln | |
| BLDpharm | 100mg | 403.22 Pln | |
| BLDpharm | 250mg | 647.57 Pln | |
| BLDpharm | 1g | 1586.13 Pln | |
| BLDpharm | 5g | 5429.22 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-(2-butan-2-ylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2621936-59-0) is a chemical compound with the molecular formula C16H25BO2 and a molecular weight of 260.2 g/mol. IUPAC name: 2-(2-butan-2-ylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: CYAYKTOSJWSNQY-UHFFFAOYSA-N.
| Molecular formula | C16H25BO2 |
|---|---|
| Molecular weight | 260.2 g/mol |
| IUPAC name | 2-(2-butan-2-ylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | CYAYKTOSJWSNQY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2C(C)CC |
Computed by PubChem (NCBI)
Synonyms:
2-[2-(butan-2-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-(2-(butan-2-yl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-(2-(sec-Butyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-(2-Butan-2-ylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 4,4,5,5-tetramethyl-2-(2-sec-butylphenyl)-1,3,2-dioxaborolane, 4,4,5,5-Tetramethyl-2-[2-(1-methylpropyl)phenyl]-1,3,2-dioxaborolane