Products 167693-07-4

CAS 167693-07-4 is the registry number for 4,4,5,5-Tetramethyl-2-(4-phenylbutyl)-1,3,2-dioxaborolane, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

4,4,5,5-tetramethyl-2-(4-phenylbutyl)-1,3,2-dioxaborolane (CAS 167693-07-4) is a chemical compound with the molecular formula C16H25BO2 and a molecular weight of 260.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-phenylbutyl)-1,3,2-dioxaborolane. InChIKey: LUQAEJIBGOMWPJ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H25BO2
Molecular weight260.2 g/mol
IUPAC name4,4,5,5-tetramethyl-2-(4-phenylbutyl)-1,3,2-dioxaborolane
InChIKeyLUQAEJIBGOMWPJ-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)CCCCC2=CC=CC=C2

Computed by PubChem (NCBI)