CAS 2782691-02-3 is the registry number for 2-(5-Isopropyl-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: AmBeed. Available pack sizes: 1g.
4,4,5,5-tetramethyl-2-(2-methyl-5-propan-2-ylphenyl)-1,3,2-dioxaborolane (CAS 2782691-02-3) is a chemical compound with the molecular formula C16H25BO2 and a molecular weight of 260.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-methyl-5-propan-2-ylphenyl)-1,3,2-dioxaborolane. InChIKey: KGUQLHORWZSPGI-UHFFFAOYSA-N.
| Molecular formula | C16H25BO2 |
|---|---|
| Molecular weight | 260.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2-methyl-5-propan-2-ylphenyl)-1,3,2-dioxaborolane |
| InChIKey | KGUQLHORWZSPGI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C(C)C)C |
Computed by PubChem (NCBI)