cas: 1147-43-9 — see every product listed under this CAS number, including other names
2-(2-Aminobenzoyl)benzoic acid, 98% (CAS 1147-43-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F547187-250MG |
| cas | 1147-43-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 513.38 Pln | |
| Fluorochem | 10g | 815.36 Pln | |
| Fluorochem | 25g | 1559.89 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(2-aminobenzoyl)benzoic acid (CAS 1147-43-9) is a chemical compound with the molecular formula C14H11NO3 and a molecular weight of 241.24 g/mol. IUPAC name: 2-(2-aminobenzoyl)benzoic acid. InChIKey: KORKIRUGUNPQML-UHFFFAOYSA-N.
| Molecular formula | C14H11NO3 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | 2-(2-aminobenzoyl)benzoic acid |
| InChIKey | KORKIRUGUNPQML-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC=CC=C2N)C(=O)O |
Computed by PubChem (NCBI)