CAS 4727-29-1 appears in our catalog under these names: Phthalanillic acid, 95%, Phthalanilic Acid (~90%), >95% (HPLC), 2-(Phenylcarbamoyl)benzoic Acid, >95.0%(HPLC)(T). Offered by: Combi-blocks, TRC, TCI. Available pack sizes: 5g, 10g, 1g.
2-(phenylcarbamoyl)benzoic acid (CAS 4727-29-1) is a chemical compound with the molecular formula C14H11NO3 and a molecular weight of 241.24 g/mol. IUPAC name: 2-(phenylcarbamoyl)benzoic acid. InChIKey: DSUPUOGOCIFZBG-UHFFFAOYSA-N.
| Molecular formula | C14H11NO3 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | 2-(phenylcarbamoyl)benzoic acid |
| InChIKey | DSUPUOGOCIFZBG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)