cas: 81682-38-4 — see every product listed under this CAS number, including other names
2-(2-Bromo-5-chlorophenyl)acetic acid 97% (CAS 81682-38-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A100940-5g |
| cas | 81682-38-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 264.69 Pln | |
| Ambeed | 100g | 837.62 Pln | |
| Ambeed | 500g | 3913.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A100940 |
2-(2-bromo-5-chlorophenyl)acetic acid (CAS 81682-38-4) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: 2-(2-bromo-5-chlorophenyl)acetic acid. InChIKey: ZPSZXWVBMOMXED-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO2 |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | 2-(2-bromo-5-chlorophenyl)acetic acid |
| InChIKey | ZPSZXWVBMOMXED-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)CC(=O)O)Br |
Computed by PubChem (NCBI)