cas: 1879-56-7 — see every product listed under this CAS number, including other names
2-(2-Bromophenoxy)acetic acid 98% (CAS 1879-56-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A745291-1g |
| cas | 1879-56-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 370.38 Pln | |
| Ambeed | 10g | 498.31 Pln | |
| Ambeed | 25g | 926.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A745291 |
2-(2-bromophenoxy)acetic acid (CAS 1879-56-7) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 2-(2-bromophenoxy)acetic acid. InChIKey: AZYODYPUWJPKOI-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 2-(2-bromophenoxy)acetic acid |
| InChIKey | AZYODYPUWJPKOI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OCC(=O)O)Br |
Computed by PubChem (NCBI)