2-(2-Chloro-4-Methylphenyl)-4,4,5,5-Tetramethyl-1,3,2-Dioxaborolane, 97%
cas: 1144097-12-0 — see every product listed under this CAS number, including other names
2-(2-Chloro-4-Methylphenyl)-4,4,5,5-Tetramethyl-1,3,2-Dioxaborolane, 97% (CAS 1144097-12-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12JRHK-100mg |
| cas | 1144097-12-0 |
| size | 100mg |
| availability | 20g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 750.80 Pln | |
| Chemat | 10g | 1302.80 Pln | |
| Fluorochem | 100mg | 154.13 Pln | |
| Fluorochem | 250mg | 200.99 Pln | |
| Fluorochem | 1g | 404.04 Pln | |
| Fluorochem | 5g | 1393.28 Pln | |
| Fluorochem | 10g | 2418.96 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(2-chloro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1144097-12-0) is a chemical compound with the molecular formula C13H18BClO2 and a molecular weight of 252.55 g/mol. IUPAC name: 2-(2-chloro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: JQGJYYVZYCVUFV-UHFFFAOYSA-N.
| Molecular formula | C13H18BClO2 |
|---|---|
| Molecular weight | 252.55 g/mol |
| IUPAC name | 2-(2-chloro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | JQGJYYVZYCVUFV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C)Cl |
Computed by PubChem (NCBI)