cas: 82097-01-6 — see every product listed under this CAS number, including other names
2-(2-Chloroethoxy)benzenesulfonamide 99% (CAS 82097-01-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A413708-5g |
| cas | 82097-01-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 25g | 242.44 Pln | |
| Ambeed | 100g | 620.69 Pln | |
| Ambeed | 500g | 1983.50 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A413708 |
2-(2-chloroethoxy)benzenesulfonamide (CAS 82097-01-6) is a chemical compound with the molecular formula C8H10ClNO3S and a molecular weight of 235.69 g/mol. IUPAC name: 2-(2-chloroethoxy)benzenesulfonamide. InChIKey: WAJIUYJWAGLDAC-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO3S |
|---|---|
| Molecular weight | 235.69 g/mol |
| IUPAC name | 2-(2-chloroethoxy)benzenesulfonamide |
| InChIKey | WAJIUYJWAGLDAC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OCCCl)S(=O)(=O)N |
Computed by PubChem (NCBI)