CAS 88-56-2 appears in our catalog under these names: 2–AMINO–5–CHLORO–4–ETHYLBENZENESULFONIC ACID, 2-Amino-5-chloro-4-ethylbenzenesulfonic acid, 97%. Offered by: GLPBio, Chemat Brand. Available pack sizes: 250mg, on request.
2-amino-5-chloro-4-ethylbenzenesulfonic acid (CAS 88-56-2) is a chemical compound with the molecular formula C8H10ClNO3S and a molecular weight of 235.69 g/mol. IUPAC name: 2-amino-5-chloro-4-ethylbenzenesulfonic acid. InChIKey: DJOIZOKQHNHZPN-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO3S |
|---|---|
| Molecular weight | 235.69 g/mol |
| IUPAC name | 2-amino-5-chloro-4-ethylbenzenesulfonic acid |
| InChIKey | DJOIZOKQHNHZPN-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(C=C1Cl)S(=O)(=O)O)N |
Computed by PubChem (NCBI)