CAS 2671832-32-7 is the registry number for 2-(1-Methyl-6-oxo-1,6-dihydropyridin-2-yl)ethane-1-sulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1-methyl-6-oxo-2-pyridinyl)ethanesulfonyl chloride (CAS 2671832-32-7) is a chemical compound with the molecular formula C8H10ClNO3S and a molecular weight of 235.69 g/mol. IUPAC name: 2-(1-methyl-6-oxo-2-pyridinyl)ethanesulfonyl chloride. InChIKey: JAVJCLIOHLPWHM-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO3S |
|---|---|
| Molecular weight | 235.69 g/mol |
| IUPAC name | 2-(1-methyl-6-oxo-2-pyridinyl)ethanesulfonyl chloride |
| InChIKey | JAVJCLIOHLPWHM-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C=CC=C1CCS(=O)(=O)Cl |
Computed by PubChem (NCBI)