Products 2671832-32-7

CAS 2671832-32-7 is the registry number for 2-(1-Methyl-6-oxo-1,6-dihydropyridin-2-yl)ethane-1-sulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(1-methyl-6-oxo-2-pyridinyl)ethanesulfonyl chloride (CAS 2671832-32-7) is a chemical compound with the molecular formula C8H10ClNO3S and a molecular weight of 235.69 g/mol. IUPAC name: 2-(1-methyl-6-oxo-2-pyridinyl)ethanesulfonyl chloride. InChIKey: JAVJCLIOHLPWHM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10ClNO3S
Molecular weight235.69 g/mol
IUPAC name2-(1-methyl-6-oxo-2-pyridinyl)ethanesulfonyl chloride
InChIKeyJAVJCLIOHLPWHM-UHFFFAOYSA-N
SMILESCN1C(=O)C=CC=C1CCS(=O)(=O)Cl

Computed by PubChem (NCBI)