cas: 82097-01-6 — see every product listed under this CAS number, including other names
2-(2-Chloroethoxy)benzenesulfonamide, 99% (CAS 82097-01-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F241088-5G |
| cas | 82097-01-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 138.51 Pln | |
| Fluorochem | 25g | 315.53 Pln | |
| Fluorochem | 100g | 883.04 Pln |
| purity | 99% |
|---|---|
| delivery time | 3-4 weeks |
2-(2-chloroethoxy)benzenesulfonamide (CAS 82097-01-6) is a chemical compound with the molecular formula C8H10ClNO3S and a molecular weight of 235.69 g/mol. IUPAC name: 2-(2-chloroethoxy)benzenesulfonamide. InChIKey: WAJIUYJWAGLDAC-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO3S |
|---|---|
| Molecular weight | 235.69 g/mol |
| IUPAC name | 2-(2-chloroethoxy)benzenesulfonamide |
| InChIKey | WAJIUYJWAGLDAC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OCCCl)S(=O)(=O)N |
Computed by PubChem (NCBI)