CAS 199590-75-5 is the registry number for 5-Chloro-2-methoxy-4-methylbenzenesulfonamide, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-chloro-2-methoxy-4-methylbenzenesulfonamide (CAS 199590-75-5) is a chemical compound with the molecular formula C8H10ClNO3S and a molecular weight of 235.69 g/mol. IUPAC name: 5-chloro-2-methoxy-4-methylbenzenesulfonamide. InChIKey: VQHIRMCXZNAVRG-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO3S |
|---|---|
| Molecular weight | 235.69 g/mol |
| IUPAC name | 5-chloro-2-methoxy-4-methylbenzenesulfonamide |
| InChIKey | VQHIRMCXZNAVRG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)S(=O)(=O)N)OC |
Computed by PubChem (NCBI)