cas: 82097-01-6 — see every product listed under this CAS number, including other names
2-(2-Chloroethoxy)benzenesulfonamide, 99%, 99% (CAS 82097-01-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116BXN-5g |
| cas | 82097-01-6 |
| size | 5g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 102.80 Pln | |
| Chemat | 25g | 208.40 Pln | |
| Chemat | 100g | 482.00 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
2-(2-chloroethoxy)benzenesulfonamide (CAS 82097-01-6) is a chemical compound with the molecular formula C8H10ClNO3S and a molecular weight of 235.69 g/mol. IUPAC name: 2-(2-chloroethoxy)benzenesulfonamide. InChIKey: WAJIUYJWAGLDAC-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO3S |
|---|---|
| Molecular weight | 235.69 g/mol |
| IUPAC name | 2-(2-chloroethoxy)benzenesulfonamide |
| InChIKey | WAJIUYJWAGLDAC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OCCCl)S(=O)(=O)N |
Computed by PubChem (NCBI)