cas: 65709-26-4 — see every product listed under this CAS number, including other names
2-(2-Chlorophenyl)piperazine dihydrochloride, 98% (CAS 65709-26-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g. Offered by: AmBeed, Fluorochem, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A598589-5g |
| cas | 65709-26-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 7556.50 Pln | |
| Fluorochem | 100mg | 461.31 Pln | |
| Fluorochem | 250mg | 643.54 Pln | |
| Fluorochem | 500mg | 961.14 Pln | |
| Fluorochem | 1g | 1580.71 Pln | |
| Fluorochem | 5g | 4866.01 Pln | |
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 347.60 Pln | |
| Chemat | 1g | 904.40 Pln | |
| Chemat | 5g | 3270.80 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(2-chlorophenyl)piperazine;dihydrochloride (CAS 65709-26-4) is a chemical compound with the molecular formula C10H15Cl3N2 and a molecular weight of 269.6 g/mol. IUPAC name: 2-(2-chlorophenyl)piperazine;dihydrochloride. InChIKey: POXHDYKWRXBEAH-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl3N2 |
|---|---|
| Molecular weight | 269.6 g/mol |
| IUPAC name | 2-(2-chlorophenyl)piperazine;dihydrochloride |
| InChIKey | POXHDYKWRXBEAH-UHFFFAOYSA-N |
| SMILES | C1CNC(CN1)C2=CC=CC=C2Cl.Cl.Cl |
Computed by PubChem (NCBI)