CAS 51639-49-7 appears in our catalog under these names: 1-(3-chlorophenyl)piperazine dihydrochloride, 96%, 1-(3-Chlorophenyl)piperazine dihydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100g, 500g, 25g, 5g, 10g.
1-(3-chlorophenyl)piperazine;dihydrochloride (CAS 51639-49-7) is a chemical compound with the molecular formula C10H15Cl3N2 and a molecular weight of 269.6 g/mol. IUPAC name: 1-(3-chlorophenyl)piperazine;dihydrochloride. InChIKey: OSZCTRWSGNWWBL-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl3N2 |
|---|---|
| Molecular weight | 269.6 g/mol |
| IUPAC name | 1-(3-chlorophenyl)piperazine;dihydrochloride |
| InChIKey | OSZCTRWSGNWWBL-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC(=CC=C2)Cl.Cl.Cl |
Computed by PubChem (NCBI)