CAS 957035-41-5 is the registry number for 4,5-Dichloro-N1-isobutylphenylene-1,2-diamine hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.
4,5-dichloro-2-N-(2-methylpropyl)benzene-1,2-diamine;hydrochloride (CAS 957035-41-5) is a chemical compound with the molecular formula C10H15Cl3N2 and a molecular weight of 269.6 g/mol. IUPAC name: 4,5-dichloro-2-N-(2-methylpropyl)benzene-1,2-diamine;hydrochloride. InChIKey: AFTKEWSQGGSBNV-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl3N2 |
|---|---|
| Molecular weight | 269.6 g/mol |
| IUPAC name | 4,5-dichloro-2-N-(2-methylpropyl)benzene-1,2-diamine;hydrochloride |
| InChIKey | AFTKEWSQGGSBNV-UHFFFAOYSA-N |
| SMILES | CC(C)CNC1=CC(=C(C=C1N)Cl)Cl.Cl |
Computed by PubChem (NCBI)