CAS 1185157-51-0 appears in our catalog under these names: 2-(4-Chlorophenyl)piperazine dihydrochloride, 95%, 2-(4-Chlorophenyl)piperazine DiHCl, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g.
2-(4-chlorophenyl)piperazine;dihydrochloride (CAS 1185157-51-0) is a chemical compound with the molecular formula C10H15Cl3N2 and a molecular weight of 269.6 g/mol. IUPAC name: 2-(4-chlorophenyl)piperazine;dihydrochloride. InChIKey: FKKKAACZISPRMO-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl3N2 |
|---|---|
| Molecular weight | 269.6 g/mol |
| IUPAC name | 2-(4-chlorophenyl)piperazine;dihydrochloride |
| InChIKey | FKKKAACZISPRMO-UHFFFAOYSA-N |
| SMILES | C1CNC(CN1)C2=CC=C(C=C2)Cl.Cl.Cl |
Computed by PubChem (NCBI)