CAS 1788601-98-8 appears in our catalog under these names: 2,3-Dichloro-N-(2-(dimethylamino)ethyl)aniline hydrochloride, 95%, 2,3-Dichloro-N-(2-(dimethylamino)ethyl)aniline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
N-(2,3-dichlorophenyl)-N',N'-dimethylethane-1,2-diamine;hydrochloride (CAS 1788601-98-8) is a chemical compound with the molecular formula C10H15Cl3N2 and a molecular weight of 269.6 g/mol. IUPAC name: N-(2,3-dichlorophenyl)-N',N'-dimethylethane-1,2-diamine;hydrochloride. InChIKey: RDTYXMIKPSYZSZ-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl3N2 |
|---|---|
| Molecular weight | 269.6 g/mol |
| IUPAC name | N-(2,3-dichlorophenyl)-N',N'-dimethylethane-1,2-diamine;hydrochloride |
| InChIKey | RDTYXMIKPSYZSZ-UHFFFAOYSA-N |
| SMILES | CN(C)CCNC1=C(C(=CC=C1)Cl)Cl.Cl |
Computed by PubChem (NCBI)