CAS 1432026-45-3 is the registry number for 3-Chloro-4-(pyrrolidin-1-yl)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-chloro-4-pyrrolidin-1-ylaniline;dihydrochloride (CAS 1432026-45-3) is a chemical compound with the molecular formula C10H15Cl3N2 and a molecular weight of 269.6 g/mol. IUPAC name: 3-chloro-4-pyrrolidin-1-ylaniline;dihydrochloride. InChIKey: OTUIZYHATLKXRN-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl3N2 |
|---|---|
| Molecular weight | 269.6 g/mol |
| IUPAC name | 3-chloro-4-pyrrolidin-1-ylaniline;dihydrochloride |
| InChIKey | OTUIZYHATLKXRN-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=C(C=C(C=C2)N)Cl.Cl.Cl |
Computed by PubChem (NCBI)