cas: 4490-75-9 — see every product listed under this CAS number, including other names
2-(2-Mercaptoethyl)isoindoline-1,3-dione 96% (CAS 4490-75-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A655545-250mg |
| cas | 4490-75-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 609.56 Pln | |
| Ambeed | 1g | 1288.19 Pln | |
| Ambeed | 50mg | 253.56 Pln | |
| Ambeed | 100mg | 375.94 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A655545 |
2-(2-sulfanylethyl)isoindole-1,3-dione (CAS 4490-75-9) is a chemical compound with the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. IUPAC name: 2-(2-sulfanylethyl)isoindole-1,3-dione. InChIKey: UHOPWFKONJYLCF-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2S |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | 2-(2-sulfanylethyl)isoindole-1,3-dione |
| InChIKey | UHOPWFKONJYLCF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCS |
Computed by PubChem (NCBI)