CAS 192948-01-9 appears in our catalog under these names: 2-Methyl-7-benzothiazolecarboxylic acid methyl ester, 95%, Methyl 2–methyl–1,3–benzothiazole–7–carboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Methyl 2-methyl-1,3-benzothiazole-7-carboxylate (CAS 192948-01-9) is a chemical compound with the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. IUPAC name: methyl 2-methyl-1,3-benzothiazole-7-carboxylate. InChIKey: MJNXLPDXVUYYQG-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2S |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | methyl 2-methyl-1,3-benzothiazole-7-carboxylate |
| InChIKey | MJNXLPDXVUYYQG-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC=CC(=C2S1)C(=O)OC |
Computed by PubChem (NCBI)