CAS 4490-75-9 appears in our catalog under these names: 2-(2-Mercaptoethyl)isoindoline-1,3-dione, 96%, 2-(2-Mercaptoethyl)isoindoline-1,3-dione, 95+%, 2-(2-Mercaptoethyl)isoindoline-1,3-dione 96%, 2-(2-Mercaptoethyl)isoindoline-1,3-dione, 96%, 96%, 2-(2-Mercaptoethyl)isoindoline-1,3-dione, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 1g, 5g, 50mg, 100mg.
2-(2-sulfanylethyl)isoindole-1,3-dione (CAS 4490-75-9) is a chemical compound with the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. IUPAC name: 2-(2-sulfanylethyl)isoindole-1,3-dione. InChIKey: UHOPWFKONJYLCF-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2S |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | 2-(2-sulfanylethyl)isoindole-1,3-dione |
| InChIKey | UHOPWFKONJYLCF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCS |
Computed by PubChem (NCBI)