CAS 62096-93-9 appears in our catalog under these names: (4R)-2-phenyl-4,5-dihydro-1,3-thiazole-4-carboxylic acid, 95%, (R)-2-Phenyl-4,5-dihydrothiazole-4-carboxylic acid, 97%, (4R)-2-Phenyl-4,5-dihydro-1,3-thiazole-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
(4R)-2-phenyl-4,5-dihydro-1,3-thiazole-4-carboxylic acid (CAS 62096-93-9) is a chemical compound with the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. IUPAC name: (4R)-2-phenyl-4,5-dihydro-1,3-thiazole-4-carboxylic acid. InChIKey: HOZQYTNELGLJMC-QMMMGPOBSA-N.
| Molecular formula | C10H9NO2S |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | (4R)-2-phenyl-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| InChIKey | HOZQYTNELGLJMC-QMMMGPOBSA-N |
| SMILES | C1[C@H](N=C(S1)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)