cas: 4490-75-9 — see every product listed under this CAS number, including other names
2-(2-Mercaptoethyl)isoindoline-1,3-dione, 96%, 96% (CAS 4490-75-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118299-50mg |
| cas | 4490-75-9 |
| size | 50mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 194.00 Pln | |
| Chemat | 100mg | 285.20 Pln | |
| Chemat | 250mg | 458.00 Pln | |
| Chemat | 1g | 1134.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-(2-sulfanylethyl)isoindole-1,3-dione (CAS 4490-75-9) is a chemical compound with the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. IUPAC name: 2-(2-sulfanylethyl)isoindole-1,3-dione. InChIKey: UHOPWFKONJYLCF-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2S |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | 2-(2-sulfanylethyl)isoindole-1,3-dione |
| InChIKey | UHOPWFKONJYLCF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCS |
Computed by PubChem (NCBI)