CAS 116269-85-3 appears in our catalog under these names: 4-(3-Methoxyphenyl)-2,3-dihydro-1,3-thiazol-2-one, 95%, 4-(3-Methoxyphenyl)-2,3-dihydro-1,3-thiazol-2-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
4-(3-methoxyphenyl)-3H-1,3-thiazol-2-one (CAS 116269-85-3) is a chemical compound with the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. IUPAC name: 4-(3-methoxyphenyl)-3H-1,3-thiazol-2-one. InChIKey: FMROXOWLZSPZIM-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2S |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | 4-(3-methoxyphenyl)-3H-1,3-thiazol-2-one |
| InChIKey | FMROXOWLZSPZIM-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CSC(=O)N2 |
Computed by PubChem (NCBI)