Products 202584-21-2
CAS 202584-21-2 appears in our catalog under these names: 6-(Methylthio)-1H-indole-2-carboxylic acid, 6-(Methylsulfanyl)-1h-indole-2-carboxylic acid, 95%, 6-(Methylthio)-1H-indole-2-carboxylic acid, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 250mg, 2,5g, 1g, 100mg, 10g.
6-methylsulfanyl-1H-indole-2-carboxylic acid (CAS 202584-21-2) is a chemical compound with the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. IUPAC name: 6-methylsulfanyl-1H-indole-2-carboxylic acid. InChIKey: OJPNRJVMABFYLM-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2S |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | 6-methylsulfanyl-1H-indole-2-carboxylic acid |
| InChIKey | OJPNRJVMABFYLM-UHFFFAOYSA-N |
| SMILES | CSC1=CC2=C(C=C1)C=C(N2)C(=O)O |
Computed by PubChem (NCBI)