2-(2-methyl-6-nitrophenyl)acetic acid, 98%
cas: 23876-18-8 — see every product listed under this CAS number, including other names
2-(2-methyl-6-nitrophenyl)acetic acid, 98% (CAS 23876-18-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | CA-4082-250mg |
| cas | 23876-18-8 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Ambeed | 100mg | 197.94 Pln | |
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 403.75 Pln | |
| Ambeed | 5g | 1282.62 Pln | |
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 434.00 Pln | |
| Chemat | 5g | 1302.80 Pln | |
| Fluorochem | 1g | 404.04 Pln | |
| Fluorochem | 5g | 1325.59 Pln | |
| BLDpharm | 100mg | 197.73 Pln | |
| BLDpharm | 250mg | 258.82 Pln | |
| BLDpharm | 1g | 430.98 Pln | |
| BLDpharm | 5g | 1375.10 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2-(2-methyl-6-nitrophenyl)acetic acid (CAS 23876-18-8) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 2-(2-methyl-6-nitrophenyl)acetic acid. InChIKey: WFKNETIJXXWRHO-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 2-(2-methyl-6-nitrophenyl)acetic acid |
| InChIKey | WFKNETIJXXWRHO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)[N+](=O)[O-])CC(=O)O |
Computed by PubChem (NCBI)