Products 35193-44-3
CAS 35193-44-3 appears in our catalog under these names: 3–ethyl–2–nitrobenzoic acid, 3-Ethyl-2-nitrobenzoic acid, 95%, 3-ETHYL-2-NITROBENZOIC ACID, 98%, 3-Ethyl-2-nitrobenzoic acid, 98%, 98%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 100mg, 25mg, 5g, 250mg, 1g.
3-ethyl-2-nitrobenzoic acid (CAS 35193-44-3) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 3-ethyl-2-nitrobenzoic acid. InChIKey: JFOWATROJMCOHF-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 3-ethyl-2-nitrobenzoic acid |
| InChIKey | JFOWATROJMCOHF-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=CC=C1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)