Products 27022-97-5
CAS 27022-97-5 appears in our catalog under these names: 2,5-Dimethyl-3-nitrobenzoic acid, 95%, 2，5–Dimethyl–3–nitrobenzoic acid, 2,5-Dimethyl-3-nitrobenzoic acid, 2,5-Dimethyl-3-nitrobenzoic acid, 95%, 95%, 2,5-Dimethyl-3-nitrobenzoic acid, min. 95 %, 250 mg. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Roth. Available pack sizes: 250mg, 1g, 5g, 2000mg, 1000mg, 5000mg, 500mg, 2g.
2,5-dimethyl-3-nitrobenzoic acid (CAS 27022-97-5) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 2,5-dimethyl-3-nitrobenzoic acid. InChIKey: CXGZFDGAQVAGHA-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 2,5-dimethyl-3-nitrobenzoic acid |
| InChIKey | CXGZFDGAQVAGHA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)[N+](=O)[O-])C)C(=O)O |
Computed by PubChem (NCBI)