Products 6307-70-6
CAS 6307-70-6 appears in our catalog under these names: 2,6-Dimethyl-3-nitrobenzoic acid, 95%, 2,6-Dimethyl-3-nitrobenzoic acid, 2,6-Dimethyl-3-nitrobenzoic acid 97%, 2,6-Dimethyl-3-nitrobenzoic acid, 97%, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 10g, 1g, 0,5g, 100mg.
2,6-dimethyl-3-nitrobenzoic acid (CAS 6307-70-6) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 2,6-dimethyl-3-nitrobenzoic acid. InChIKey: GOGALNMBJIGJNW-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 2,6-dimethyl-3-nitrobenzoic acid |
| InChIKey | GOGALNMBJIGJNW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)[N+](=O)[O-])C)C(=O)O |
Computed by PubChem (NCBI)