Products 74319-96-3

CAS 74319-96-3 appears in our catalog under these names: 3,4-Dimethyl-5-nitrobenzoic acid, 95%, 3,4-Dimethyl-5-nitrobenzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

3,4-dimethyl-5-nitrobenzoic acid (CAS 74319-96-3) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 3,4-dimethyl-5-nitrobenzoic acid. InChIKey: YHDUXEJQMSMFFI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9NO4
Molecular weight195.17 g/mol
IUPAC name3,4-dimethyl-5-nitrobenzoic acid
InChIKeyYHDUXEJQMSMFFI-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1C)[N+](=O)[O-])C(=O)O

Computed by PubChem (NCBI)