CAS 1796-83-4 appears in our catalog under these names: 3,4-Dimethyl pyridine-3,4-dicarboxylate, 98%, Dimethyl pyridine–3,4–dicarboxylate, Dimethyl pyridine-3,4-dicarboxylate, Dimethyl pyridine-3,4-dicarboxylate 98%, Dimethyl pyridine-3,4-dicarboxylate, 96%, 96%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 2g, 100mg.
Dimethyl pyridine-3,4-dicarboxylate (CAS 1796-83-4) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: dimethyl pyridine-3,4-dicarboxylate. InChIKey: AUQUSBAFIHOGHK-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | dimethyl pyridine-3,4-dicarboxylate |
| InChIKey | AUQUSBAFIHOGHK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=NC=C1)C(=O)OC |
Computed by PubChem (NCBI)