CAS 436853-63-3 appears in our catalog under these names: 3,5–dimethylphenylboronic acid–1,3–propanediol ester, 2-(3,5-Dimethylphenyl)-1,3,2-dioxaborinane, 98%, 98%, 2-(3,5-Dimethylphenyl)-1,3,2-dioxaborinane, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
2-(3,5-dimethylphenyl)-1,3,2-dioxaborinane (CAS 436853-63-3) is a chemical compound with the molecular formula C11H15BO2 and a molecular weight of 190.05 g/mol. IUPAC name: 2-(3,5-dimethylphenyl)-1,3,2-dioxaborinane. InChIKey: BBDURTGMHLDAQY-UHFFFAOYSA-N.
| Molecular formula | C11H15BO2 |
|---|---|
| Molecular weight | 190.05 g/mol |
| IUPAC name | 2-(3,5-dimethylphenyl)-1,3,2-dioxaborinane |
| InChIKey | BBDURTGMHLDAQY-UHFFFAOYSA-N |
| SMILES | B1(OCCCO1)C2=CC(=CC(=C2)C)C |
Computed by PubChem (NCBI)