2-(3,5-dibromo-4-methoxyphenyl)acetic acid
cas: 89936-29-8 — see every product listed under this CAS number, including other names
2-(3,5-dibromo-4-methoxyphenyl)acetic acid (CAS 89936-29-8) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg. Offered by: TargetMol, Chemat.
| brand | TargetMol |
|---|---|
| catalog number | TN7135-1mg |
| cas | 89936-29-8 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1mg | 1428.68 Pln | |
| TargetMol | 2mg | 2046.38 Pln | |
| TargetMol | 5mg | 3022.39 Pln | |
| TargetMol | 10mg | 4350.58 Pln | |
| TargetMol | 25mg | 6422.79 Pln | |
| TargetMol | 50mg | 8906.43 Pln | |
| Chemat | 2mg | 1384.40 Pln | |
| Chemat | 1mg | 582.80 Pln | |
| Chemat | 5mg | 1288.40 Pln | |
| Chemat | 10mg | 1864.40 Pln | |
| Chemat | 25mg | 2901.20 Pln | |
| Chemat | 50mg | 3976.40 Pln |
properties
| purity | No data |
|---|---|
| delivery time | approx. 19 days |
2-(3,5-dibromo-4-methoxyphenyl)acetic acid (CAS 89936-29-8) is a chemical compound with the molecular formula C9H8Br2O3 and a molecular weight of 323.97 g/mol. IUPAC name: 2-(3,5-dibromo-4-methoxyphenyl)acetic acid. InChIKey: PXJNCNLURDNKJO-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2O3 |
|---|---|
| Molecular weight | 323.97 g/mol |
| IUPAC name | 2-(3,5-dibromo-4-methoxyphenyl)acetic acid |
| InChIKey | PXJNCNLURDNKJO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1Br)CC(=O)O)Br |
Computed by PubChem (NCBI)