Products 38206-97-2

CAS 38206-97-2 is the registry number for 2-(2,6-Dibromo-4-methylphenoxy)acetic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(2,6-dibromo-4-methylphenoxy)acetic acid (CAS 38206-97-2) is a chemical compound with the molecular formula C9H8Br2O3 and a molecular weight of 323.97 g/mol. IUPAC name: 2-(2,6-dibromo-4-methylphenoxy)acetic acid. InChIKey: HSAWQOYEJFEMOK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8Br2O3
Molecular weight323.97 g/mol
IUPAC name2-(2,6-dibromo-4-methylphenoxy)acetic acid
InChIKeyHSAWQOYEJFEMOK-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1)Br)OCC(=O)O)Br

Computed by PubChem (NCBI)