Products 6965-70-4
CAS 6965-70-4 appears in our catalog under these names: 2–(2，4–Dibromophenoxy)propanoic acid, 2-(2,4-Dibromophenoxy)propanoic acid 95+%, 2-(2,4-Dibromophenoxy)propanoic acid, 95+%, 95+%, 2-(2,4-dibromophenoxy)propanoic acid, 95+%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 10g.
2-(2,4-dibromophenoxy)propanoic acid (CAS 6965-70-4) is a chemical compound with the molecular formula C9H8Br2O3 and a molecular weight of 323.97 g/mol. IUPAC name: 2-(2,4-dibromophenoxy)propanoic acid. InChIKey: BNJNLGGUPKGAHB-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2O3 |
|---|---|
| Molecular weight | 323.97 g/mol |
| IUPAC name | 2-(2,4-dibromophenoxy)propanoic acid |
| InChIKey | BNJNLGGUPKGAHB-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)OC1=C(C=C(C=C1)Br)Br |
Computed by PubChem (NCBI)