CAS 76251-01-9 is the registry number for Methyl 2-(3,5-dibromo-2-hydroxyphenyl)acetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
Methyl 2-(3,5-dibromo-2-hydroxyphenyl)acetate (CAS 76251-01-9) is a chemical compound with the molecular formula C9H8Br2O3 and a molecular weight of 323.97 g/mol. IUPAC name: methyl 2-(3,5-dibromo-2-hydroxyphenyl)acetate. InChIKey: XDOIIYQCWBRFOY-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2O3 |
|---|---|
| Molecular weight | 323.97 g/mol |
| IUPAC name | methyl 2-(3,5-dibromo-2-hydroxyphenyl)acetate |
| InChIKey | XDOIIYQCWBRFOY-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=C(C(=CC(=C1)Br)Br)O |
Computed by PubChem (NCBI)