CAS 875246-05-2 is the registry number for Methyl 2,4-dibromo-5-methoxybenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
Methyl 2,4-dibromo-5-methoxybenzoate (CAS 875246-05-2) is a chemical compound with the molecular formula C9H8Br2O3 and a molecular weight of 323.97 g/mol. IUPAC name: methyl 2,4-dibromo-5-methoxybenzoate. InChIKey: PEPOTDFPFMQLFJ-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2O3 |
|---|---|
| Molecular weight | 323.97 g/mol |
| IUPAC name | methyl 2,4-dibromo-5-methoxybenzoate |
| InChIKey | PEPOTDFPFMQLFJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)OC)Br)Br |
Computed by PubChem (NCBI)