Products 875246-05-2

CAS 875246-05-2 is the registry number for Methyl 2,4-dibromo-5-methoxybenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 2,4-dibromo-5-methoxybenzoate (CAS 875246-05-2) is a chemical compound with the molecular formula C9H8Br2O3 and a molecular weight of 323.97 g/mol. IUPAC name: methyl 2,4-dibromo-5-methoxybenzoate. InChIKey: PEPOTDFPFMQLFJ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8Br2O3
Molecular weight323.97 g/mol
IUPAC namemethyl 2,4-dibromo-5-methoxybenzoate
InChIKeyPEPOTDFPFMQLFJ-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C(=C1)C(=O)OC)Br)Br

Computed by PubChem (NCBI)