CAS 89936-29-8 is the registry number for 2-(3,5-dibromo-4-methoxyphenyl)acetic acid. Offered by: TargetMol, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg.
2-(3,5-dibromo-4-methoxyphenyl)acetic acid (CAS 89936-29-8) is a chemical compound with the molecular formula C9H8Br2O3 and a molecular weight of 323.97 g/mol. IUPAC name: 2-(3,5-dibromo-4-methoxyphenyl)acetic acid. InChIKey: PXJNCNLURDNKJO-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2O3 |
|---|---|
| Molecular weight | 323.97 g/mol |
| IUPAC name | 2-(3,5-dibromo-4-methoxyphenyl)acetic acid |
| InChIKey | PXJNCNLURDNKJO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1Br)CC(=O)O)Br |
Computed by PubChem (NCBI)