cas: 1214339-37-3 — see every product listed under this CAS number, including other names
2-(3-Bromo-5-(trifluoromethyl)phenyl)-2-hydroxyacetic acid, 95+% (CAS 1214339-37-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A311012-5g |
| cas | 1214339-37-3 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 5147.80 Pln | |
| AmBeed | 25g | 9385.81 Pln | |
| AmBeed | 10g | 7771.33 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[3-bromo-5-(trifluoromethyl)phenyl]-2-hydroxyacetic acid (CAS 1214339-37-3) is a chemical compound with the molecular formula C9H6BrF3O3 and a molecular weight of 299.04 g/mol. IUPAC name: 2-[3-bromo-5-(trifluoromethyl)phenyl]-2-hydroxyacetic acid. InChIKey: ONDYSDOPVUUHLQ-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O3 |
|---|---|
| Molecular weight | 299.04 g/mol |
| IUPAC name | 2-[3-bromo-5-(trifluoromethyl)phenyl]-2-hydroxyacetic acid |
| InChIKey | ONDYSDOPVUUHLQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)Br)C(C(=O)O)O |
Computed by PubChem (NCBI)