CAS 1445995-86-7 is the registry number for 5-Bromo-2-methoxy-3-(trifluoromethyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-bromo-2-methoxy-3-(trifluoromethyl)benzoic acid (CAS 1445995-86-7) is a chemical compound with the molecular formula C9H6BrF3O3 and a molecular weight of 299.04 g/mol. IUPAC name: 5-bromo-2-methoxy-3-(trifluoromethyl)benzoic acid. InChIKey: LJLYACHFSQWEQL-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O3 |
|---|---|
| Molecular weight | 299.04 g/mol |
| IUPAC name | 5-bromo-2-methoxy-3-(trifluoromethyl)benzoic acid |
| InChIKey | LJLYACHFSQWEQL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1C(F)(F)F)Br)C(=O)O |
Computed by PubChem (NCBI)